CymitQuimica logo

CAS 88952-00-5

:

2-Acetyl-4-chlorophenyl 3-methoxybenzoate

Description:
2-Acetyl-4-chlorophenyl 3-methoxybenzoate, with the CAS number 88952-00-5, is an organic compound characterized by its complex structure, which includes an acetyl group, a chlorophenyl moiety, and a methoxybenzoate group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chlorophenyl group may impart specific electronic properties, influencing its reactivity and interactions with biological systems. Additionally, the methoxy group can enhance solubility and stability, making it suitable for various formulations. The compound's synthesis often involves esterification reactions, and its properties can be further explored through spectroscopic methods such as NMR and IR spectroscopy. Safety data sheets should be consulted for handling and storage guidelines, as with many organic compounds, it may pose certain health and environmental risks. Overall, 2-Acetyl-4-chlorophenyl 3-methoxybenzoate represents a valuable chemical entity in research and industrial applications.
Formula:C16H13ClO4
InChI:InChI=1S/C16H13ClO4/c1-10(18)14-9-12(17)6-7-15(14)21-16(19)11-4-3-5-13(8-11)20-2/h3-9H,1-2H3
InChI key:InChIKey=WYHONCKRHFNGSW-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC(OC)=CC=C1)C2=C(C(C)=O)C=C(Cl)C=C2
Synonyms:
  • 2-Acetyl-4-chlorophenyl 3-methoxybenzoate
  • Benzoic acid, 3-methoxy-, 2-acetyl-4-chlorophenyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.