CAS 88963-76-2
:3-(Acetylamino)-5-nitrobenzenesulfonyl chloride
Description:
3-(Acetylamino)-5-nitrobenzenesulfonyl chloride, with the CAS number 88963-76-2, is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features an acetylamino group and a nitro group, contributing to its unique chemical properties and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit a yellowish color due to the presence of the nitro group. The sulfonyl chloride moiety makes it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals, as it can react with amines to form sulfonamides. Additionally, the presence of both the acetylamino and nitro groups can influence its reactivity and solubility in different solvents. Safety precautions should be taken when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture.
Formula:C8H7ClN2O5S
InChI:InChI=1S/C8H7ClN2O5S/c1-5(12)10-6-2-7(11(13)14)4-8(3-6)17(9,15)16/h2-4H,1H3,(H,10,12)
InChI key:InChIKey=DKRJUDXWAXSQQA-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC(N(=O)=O)=CC(NC(C)=O)=C1
Synonyms:- 3-(Acetylamino)-5-nitrobenzenesulfonyl chloride
- 3-Acetamido-5-nitrobenzene-1-sulfonyl chloride
- Benzenesulfonyl chloride, 3-(acetylamino)-5-nitro-
- 3-Acetamido-5-nitrobenzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
