CAS 88965-53-1
:N-(2-Amino-5-benzoylphenyl)-2-propanesulfonamide
Description:
N-(2-Amino-5-benzoylphenyl)-2-propanesulfonamide, with the CAS number 88965-53-1, is a sulfonamide compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features an amino group and a benzoylphenyl moiety, contributing to its potential biological activity. The presence of the propanesulfonamide structure suggests it may exhibit solubility in polar solvents, making it suitable for various applications in medicinal chemistry. The compound's structure indicates it may interact with biological targets, potentially influencing enzyme activity or cellular processes. Additionally, sulfonamides are often associated with a range of pharmacological effects, including antimicrobial and anti-inflammatory properties. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values. Overall, this compound's unique structural features position it as a candidate for further research in drug development and therapeutic applications.
Formula:C16H18N2O3S
InChI:InChI=1S/C16H18N2O3S/c1-11(2)22(20,21)18-15-10-13(8-9-14(15)17)16(19)12-6-4-3-5-7-12/h3-11,18H,17H2,1-2H3
InChI key:InChIKey=ZCMGUGGECAKCAK-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(NS(C(C)C)(=O)=O)=C(N)C=C1)C2=CC=CC=C2
Synonyms:- 2-Propanesulfonamide, N-(2-amino-5-benzoylphenyl)-
- N-(2-Amino-5-benzoylphenyl)-2-propanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
