CAS 889675-08-5

tert-butyl 2-(1-benzyl-2-ethyl-3-oxamoyl-indol-4-yl)oxyacetate

Description:

Tert-butyl 2-(1-benzyl-2-ethyl-3-oxamoyl-indol-4-yl)oxyacetate is a complex organic compound characterized by its unique structural features, which include a tert-butyl group, an indole moiety, and an oxamic acid derivative. This compound typically exhibits moderate to high lipophilicity due to the presence of the tert-butyl group and the aromatic benzyl substituent, which can influence its solubility in organic solvents. The indole structure contributes to its potential biological activity, as indoles are known for their diverse pharmacological properties. The oxamoyl group may also impart specific reactivity or interaction capabilities, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which could affect its stability and reactivity. Overall, this substance may be explored for applications in drug development or as a chemical probe in biological research, although specific biological activity and safety profiles would require further investigation.

Formula: C₂₅H₂₈N₂O₅

InChI: InChI=1/C25H28N2O5/c1-5-17-22(23(29)24(26)30)21-18(27(17)14-16-10-7-6-8-11-16)12-9-13-19(21)31-15-20(28)32-25(2,3)4/h6-13H,5,14-15H2,1-4H3,(H2,26,30)

SMILES: CCc1c(c2c(cccc2OCC(=O)OC(C)(C)C)n1Cc1ccccc1)C(=O)C(=O)N

tert-Butyl 2-(3-(2-amino-2-oxoacetyl)-1-benzyl-2-ethyl-1H-indol-4-yloxy)acetate

Controlled Product

CAS: 889675-08-5

Please enquire for more information about tert-Butyl 2-(3-(2-amino-2-oxoacetyl)-1-benzyl-2-ethyl-1H-indol-4-yloxy)acetate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₅H₂₈N₂O₅

Purity: Min. 95%

Molecular weight: 436.5 g/mol

Ref: 3D-FB156181