CAS 88968-75-6
:1-(2,3,4-trichlorophenyl)propan-2-one
Description:
1-(2,3,4-Trichlorophenyl)propan-2-one, also known by its CAS number 88968-75-6, is an organic compound characterized by its ketone functional group and a trichlorophenyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It has a relatively low solubility in water but is more soluble in organic solvents such as ethanol and acetone. The presence of three chlorine atoms on the phenyl ring significantly influences its chemical reactivity and stability, often making it a subject of interest in various chemical syntheses and applications. The compound may exhibit biological activity, which can be explored in pharmacological studies. Additionally, its structure suggests potential uses in agrochemicals or as an intermediate in organic synthesis. Safety precautions should be taken when handling this substance, as halogenated compounds can pose environmental and health risks. Proper storage and disposal methods are essential to mitigate any hazards associated with its use.
Formula:C9H7Cl3O
InChI:InChI=1/C9H7Cl3O/c1-5(13)4-6-2-3-7(10)9(12)8(6)11/h2-3H,4H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
