CymitQuimica logo

CAS 88973-10-8

:

1-methyl-2-[(Z)-2-(methylsulfanyl)-2-piperidin-1-ylethenyl]quinolinium iodide

Description:
1-Methyl-2-[(Z)-2-(methylsulfanyl)-2-piperidin-1-ylethenyl]quinolinium iodide is a quaternary ammonium compound characterized by its complex structure, which includes a quinolinium moiety and a piperidine ring. This compound features a methylsulfanyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits solubility in polar solvents due to the presence of the quaternary ammonium ion. The iodide counterion enhances its solubility and stability in various environments. The Z-configuration of the ethenyl group indicates a specific geometric arrangement, which can influence its reactivity and interactions with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in various applications, including as a potential therapeutic agent or in the development of new materials. Safety and handling precautions should be observed due to its quaternary ammonium nature, which can pose risks in certain contexts.
Formula:C18H23IN2S
InChI:InChI=1/C18H23N2S.HI/c1-19-16(11-10-15-8-4-5-9-17(15)19)14-18(21-2)20-12-6-3-7-13-20;/h4-5,8-11,14H,3,6-7,12-13H2,1-2H3;1H/q+1;/p-1
Synonyms:
  • quinolinium, 1-methyl-2-[(Z)-2-(methylthio)-2-(1-piperidinyl)ethenyl]-, iodide (1:1)
  • 1-methyl-2-[(Z)-2-(methylsulfanyl)-2-(piperidin-1-yl)ethenyl]quinolinium iodide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.