CAS 88973-47-1
:(2E,4E)-6-hydroxyhexa-2,4-dienoic acid
Description:
(2E,4E)-6-hydroxyhexa-2,4-dienoic acid, with the CAS number 88973-47-1, is an organic compound characterized by its unique structure featuring a six-carbon chain with two double bonds and a hydroxyl group. This compound belongs to the class of unsaturated fatty acids and is notable for its conjugated diene system, which contributes to its reactivity and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its interactions in biochemical pathways. This compound is of interest in various fields, including biochemistry and organic synthesis, due to its potential role as a precursor in the synthesis of more complex molecules or as a bioactive compound. Its stability and reactivity can be affected by environmental conditions, such as pH and temperature, making it important to consider these factors in experimental applications. Overall, (2E,4E)-6-hydroxyhexa-2,4-dienoic acid exemplifies the diverse chemistry of unsaturated acids and their derivatives.
Formula:C6H8O3
InChI:InChI=1/C6H8O3/c7-5-3-1-2-4-6(8)9/h1-4,7H,5H2,(H,8,9)/b3-1+,4-2+
Synonyms:- 6-hydroxy-2,4-hexadienoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
