
CAS 88976-10-7
:2-(2-Methylpropyl)-4(3H)-quinazolinone
Description:
2-(2-Methylpropyl)-4(3H)-quinazolinone, with the CAS number 88976-10-7, is a chemical compound that belongs to the quinazolinone class, which is characterized by a fused bicyclic structure containing a quinazoline ring and a carbonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many quinazolinones. It may possess biological activity, making it of interest in medicinal chemistry, particularly for its potential pharmacological effects. The presence of the 2-methylpropyl group can influence its lipophilicity and, consequently, its interaction with biological targets. Additionally, compounds in this class are often studied for their roles in various therapeutic areas, including anti-inflammatory and anticancer activities. As with many organic compounds, the specific reactivity and stability can vary based on environmental conditions such as pH and temperature. Proper handling and safety measures should be observed when working with this substance in a laboratory setting.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-8(2)7-11-13-10-6-4-3-5-9(10)12(15)14-11/h3-6,8H,7H2,1-2H3,(H,13,14,15)
InChI key:InChIKey=GUZJGBCZBUEHTB-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(CC(C)C)=N1)=CC=CC2
Synonyms:- 4(1H)-Quinazolinone, 2-(2-methylpropyl)-
- 2-(2-Methylpropyl)quinazolin-4-ol
- 2-(2-Methylpropyl)-4(3H)-quinazolinone
- 4(3H)-Quinazolinone, 2-(2-methylpropyl)-
- 2-(2-Methylpropyl)-1H-quinazolin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
