CymitQuimica logo

CAS 88982-32-5

:

5-(Methylsulfonyl)-4H-1,2,4-triazol-3-amine

Description:
5-(Methylsulfonyl)-4H-1,2,4-triazol-3-amine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a methylsulfonyl group, which contributes to its solubility and reactivity. The presence of the amino group enhances its potential for hydrogen bonding and interactions with biological targets. It is often studied for its applications in pharmaceuticals, particularly as a potential antifungal agent or in agricultural chemistry. The compound's molecular structure allows for various functional modifications, making it a versatile intermediate in organic synthesis. Additionally, its stability under various conditions and its ability to form complexes with metal ions can be of interest in coordination chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 5-(Methylsulfonyl)-4H-1,2,4-triazol-3-amine is notable for its unique structural features and potential applications in various fields.
Formula:C3H6N4O2S
InChI:InChI=1/C3H6N4O2S/c1-10(8,9)3-5-2(4)6-7-3/h1H3,(H3,4,5,6,7)
SMILES:CS(=O)(=O)c1nc(=N)[nH][nH]1
Synonyms:
  • 3-(Methylsulfonyl)-4H-1,2,4-triazol-5-amine
  • 5-(methylsulfonyl)-1H-1,2,4-triazol-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.