CymitQuimica logo

CAS 88982-72-3

:

5-chloro-3-(methylsulfonyl)-1,2,4-thiadiazole

Description:
5-Chloro-3-(methylsulfonyl)-1,2,4-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom in a five-membered ring structure. The compound features a chlorine atom at the 5-position and a methylsulfonyl group at the 3-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the sulfonyl group enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in agrochemicals and pharmaceuticals. The compound may also demonstrate biological activity, which can be attributed to its structural features. As with many thiadiazole derivatives, it may possess antimicrobial or herbicidal properties, although specific biological activities can vary. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C3H3ClN2O2S2
InChI:InChI=1/C3H3ClN2O2S2/c1-10(7,8)3-5-2(4)9-6-3/h1H3
SMILES:CS(=O)(=O)c1nc(Cl)sn1
Synonyms:
  • 1,2,4-Thiadiazole, 5-chloro-3-(methylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.