CymitQuimica logo

CAS 88982-87-0

:

5-Isothiazolecarboxylic acid, 4-chloro-

Description:
5-Isothiazolecarboxylic acid, 4-chloro- is a heterocyclic organic compound characterized by the presence of both isothiazole and carboxylic acid functional groups. The compound features a five-membered ring containing sulfur and nitrogen atoms, which contributes to its unique chemical properties. The chlorine substituent at the 4-position of the isothiazole ring enhances its reactivity and can influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. It is often used in various applications, including agrochemicals and pharmaceuticals, due to its potential antimicrobial and herbicidal properties. The presence of the isothiazole moiety is significant in medicinal chemistry, as it can serve as a scaffold for the development of biologically active compounds. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C4H2ClNO2S
InChI:InChI=1S/C4H2ClNO2S/c5-2-1-6-9-3(2)4(7)8/h1H,(H,7,8)
InChI key:ATQDAONQAQHTEM-UHFFFAOYSA-N
SMILES:C1=NSC(=C1Cl)C(=O)O
Found 2 products.