CymitQuimica logo

CAS 88982-93-8

:

3,4,4,4-Tetrachloro-2-butenoic acid

Description:
3,4,4,4-Tetrachloro-2-butenoic acid is an organochlorine compound characterized by its four chlorine atoms attached to a butenoic acid structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its high reactivity due to the presence of multiple chlorine substituents, which can influence its chemical behavior and interactions. The presence of the carboxylic acid functional group imparts acidic properties, making it capable of participating in various chemical reactions, including esterification and nucleophilic substitution. This compound is primarily used in agricultural applications, particularly as a herbicide, due to its ability to inhibit plant growth. Additionally, it may pose environmental and health risks, necessitating careful handling and regulation. Its stability and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and field applications.
Formula:C4H2Cl4O2
InChI:InChI=1S/C4H2Cl4O2/c5-2(1-3(9)10)4(6,7)8/h1H,(H,9,10)
InChI key:InChIKey=FNCZSFIKXGUZMW-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)(C(Cl)(Cl)Cl)Cl
Synonyms:
  • 2-Butenoic acid, 3,4,4,4-tetrachloro-
  • Crotonic acid, 3,4,4,4-tetrachloro-
  • 3,4,4,4-Tetrachlorocrotonic acid
  • 3,4,4,4-Tetrachloro-2-butenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.