CAS 889851-57-4

6-(4-Ethyl-1-piperazinyl)-3-pyridinemethanamine

Description:

6-(4-Ethyl-1-piperazinyl)-3-pyridinemethanamine, identified by its CAS number 889851-57-4, is a chemical compound that features a pyridine ring substituted with a piperazine moiety. This compound typically exhibits characteristics common to amines, such as basicity due to the presence of nitrogen atoms, which can accept protons. The ethyl group on the piperazine ring contributes to its lipophilicity, potentially enhancing its ability to cross biological membranes. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the piperazine's prevalence in drug design. Additionally, the compound may exhibit specific interactions with biological receptors or enzymes, which can be explored through pharmacological studies. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other chemical species. Overall, this compound represents a class of molecules that could be of interest in drug discovery and development.

Formula: C₁₂H₂₀N₄

InChI: InChI=1S/C12H20N4/c1-2-15-5-7-16(8-6-15)12-4-3-11(9-13)10-14-12/h3-4,10H,2,5-9,13H2,1H3

InChI key: InChIKey=NYCATFJBUBUPQP-UHFFFAOYSA-N

SMILES: C(N)C1=CC=C(N=C1)N2CCN(CC)CC2

Synonyms:

• 3-Pyridinemethanamine, 6-(4-ethyl-1-piperazinyl)-
• 6-(4-Ethyl-1-piperazinyl)-3-pyridinemethanamine
• [6-(4-Ethylpiperazin-1-yl)pyridin-3-yl]methanamine