CAS 889884-60-0

7-amino-5-chloro-3H-1,3-benzoxazol-2-one

Description:

7-Amino-5-chloro-3H-1,3-benzoxazol-2-one is a chemical compound characterized by its unique structure, which includes a benzoxazole ring fused with an amino group and a chlorine substituent. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for heterocyclic compounds. The presence of the amino group suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. The chlorine atom introduces additional reactivity and can affect the compound's electronic properties, making it useful in various chemical applications, including medicinal chemistry and material science. The compound may also exhibit biological activity, which is often explored in drug development contexts. Its specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which it is analyzed. Overall, 7-amino-5-chloro-3H-1,3-benzoxazol-2-one represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₇H₅ClN₂O₂

InChI: InChI=1/C7H5ClN2O2/c8-3-1-4(9)6-5(2-3)10-7(11)12-6/h1-2H,9H2,(H,10,11)

SMILES: c1c(cc2c(c1N)oc(n2)O)Cl

7-Amino-5-chloro-2(3H)-benzoxazolone

Controlled Product

CAS: 889884-60-0

Formula: C₇H₅ClN₂O₂

Color and Shape: Neat

Molecular weight: 184.58

Ref: TR-A593875

7-Amino-5-chloro-2(3H)-benzoxazolone

CAS: 889884-60-0

7-Amino-5-chloro-2(3H)-benzoxazolone is a high quality, versatile building block that has been used in the synthesis of many complex compounds. It has been used as an intermediate for the synthesis of reagents and fine chemicals. 7-Amino-5-chloro-2(3H)-benzoxazolone can be used as a speciality chemical and research chemical. CAS No. 889884-60-0.

Formula: C₇H₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 184.58 g/mol

Ref: 3D-FA17620