CAS 889938-96-9

1-{3-[4-(trifluoromethyl)phenyl]isoxazol-5-yl}ethanol

Description:

1-{3-[4-(trifluoromethyl)phenyl]isoxazol-5-yl}ethanol, with the CAS number 889938-96-9, is a chemical compound characterized by its unique structural features, including an isoxazole ring and a trifluoromethyl group. The presence of the isoxazole moiety contributes to its potential biological activity, as isoxazoles are often found in various pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. This compound is likely to exhibit moderate to high solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the trifluoromethyl group. Additionally, the hydroxyl group (-OH) in the ethanol part of the molecule can participate in hydrogen bonding, potentially affecting its physical properties and biological interactions. Overall, this compound's unique combination of functional groups suggests it may have interesting applications in medicinal chemistry or material science, warranting further investigation into its properties and potential uses.

Formula: C₁₂H₁₀F₃NO₂

InChI: InChI=1/C12H10F3NO2/c1-7(17)11-6-10(16-18-11)8-2-4-9(5-3-8)12(13,14)15/h2-7,17H,1H3

SMILES: CC(c1cc(c2ccc(cc2)C(F)(F)F)no1)O

5-Isoxazolemethanol, a-methyl-3-[4-(trifluoromethyl)phenyl]-

CAS: 889938-96-9

Formula: C₁₂H₁₀F₃NO₂

Molecular weight: 257.2085

Ref: IN-DA00451M