CAS 889938-97-0
:1-[3-(4-Fluorophenyl)-5-isoxazolyl]ethanone
Description:
1-[3-(4-Fluorophenyl)-5-isoxazolyl]ethanone, with the CAS number 889938-97-0, is an organic compound characterized by its unique structural features, which include an isoxazole ring and a fluorophenyl group. The presence of the isoxazole moiety contributes to its potential biological activity, as this heterocyclic structure is often associated with various pharmacological properties. The fluorine atom on the phenyl ring can enhance the compound's lipophilicity and influence its interaction with biological targets. This compound is typically synthesized through specific organic reactions that involve the formation of carbon-carbon and carbon-heteroatom bonds. Its applications may extend to medicinal chemistry, where it could serve as a lead compound for the development of new therapeutic agents. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest in both research and industrial contexts. Overall, 1-[3-(4-Fluorophenyl)-5-isoxazolyl]ethanone exemplifies the complexity and diversity of organic compounds in chemical research.
Formula:C11H8FNO2
InChI:InChI=1S/C11H8FNO2/c1-7(14)11-6-10(13-15-11)8-2-4-9(12)5-3-8/h2-6H,1H3
InChI key:InChIKey=FYOVARWWAUYDFV-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(=NO1)C2=CC=C(F)C=C2
Synonyms:- Ethanone, 1-[3-(4-fluorophenyl)-5-isoxazolyl]-
- 1-[3-(4-Fluorophenyl)-1,2-oxazol-5-yl]ethan-1-one
- 1-[3-(4-Fluorophenyl)-5-isoxazolyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
