CAS 889938-98-1
:3-(3-Fluorophenyl)-α-methyl-5-isoxazolemethanol
Description:
3-(3-Fluorophenyl)-α-methyl-5-isoxazolemethanol, identified by its CAS number 889938-98-1, is a chemical compound that features a unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound is characterized by the presence of a fluorophenyl group, which can influence its electronic properties and biological activity. The α-methyl group contributes to its steric properties, potentially affecting its interactions with biological targets. The hydroxymethyl group at the 5-position of the isoxazole ring may enhance its solubility and reactivity. Compounds of this nature are often studied for their potential pharmacological applications, including anti-inflammatory or analgesic effects, due to their ability to interact with various biological pathways. The specific characteristics, such as melting point, solubility, and reactivity, would depend on the compound's molecular structure and the presence of functional groups, which can significantly influence its behavior in different environments.
Formula:C11H10FNO2
InChI:InChI=1/C11H10FNO2/c1-7(14)11-6-10(13-15-11)8-3-2-4-9(12)5-8/h2-7,14H,1H3
InChI key:InChIKey=ASTLODQXKPDEBN-UHFFFAOYSA-N
SMILES:C(C)(O)C1=CC(=NO1)C2=CC(F)=CC=C2
Synonyms:- 5-Isoxazolemethanol, 3-(3-fluorophenyl)-α-methyl-
- 3-(3-Fluorophenyl)-α-methyl-5-isoxazolemethanol
- 5(1-HYDROXYETHYL)-3(3-FLUOROPHENYL)-ISOXAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
