CAS 889938-99-2
:1-[3-(3-fluorophenyl)isoxazol-5-yl]ethanone
Description:
1-[3-(3-fluorophenyl)isoxazol-5-yl]ethanone, with the CAS number 889938-99-2, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a fluorophenyl group, indicating the presence of a fluorine atom on the phenyl ring, which can influence its electronic properties and reactivity. The ethanone moiety suggests that it has a ketone functional group, contributing to its potential reactivity in various chemical reactions. The presence of the isoxazole and the fluorinated phenyl group may impart unique biological activities, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests it may exhibit specific solubility and stability characteristics, which are important for its application in synthesis or as a potential drug candidate. Overall, the combination of these functional groups and structural features defines its chemical behavior and potential applications in various fields, including medicinal chemistry and material science.
Formula:C11H8FNO2
InChI:InChI=1/C11H8FNO2/c1-7(14)11-6-10(13-15-11)8-3-2-4-9(12)5-8/h2-6H,1H3
SMILES:CC(=O)c1cc(c2cccc(c2)F)no1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.