CAS 889939-02-0
:1-[3-(2-Pyridinyl)-5-isoxazolyl]ethanone
Description:
1-[3-(2-Pyridinyl)-5-isoxazolyl]ethanone, with the CAS number 889939-02-0, is a chemical compound characterized by its unique structural features, which include a pyridine ring and an isoxazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The isoxazole ring contributes to its stability and may influence its biological activity, making it of interest in medicinal chemistry. The presence of the pyridine ring can enhance its interaction with biological targets, potentially leading to pharmacological applications. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, 1-[3-(2-Pyridinyl)-5-isoxazolyl]ethanone represents a class of compounds that may possess interesting chemical and biological properties, warranting further investigation in various fields, including drug development and material science.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c1-7(13)10-6-9(12-14-10)8-4-2-3-5-11-8/h2-6H,1H3
InChI key:InChIKey=SNQOJMYZMZAKNA-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(=NO1)C2=CC=CC=N2
Synonyms:- Ethanone, 1-[3-(2-pyridinyl)-5-isoxazolyl]-
- 1-[3-(2-Pyridinyl)-5-isoxazolyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
