CymitQuimica logo

CAS 889939-03-1

:

1-[5-(4-Fluorophenyl)-3-isoxazolyl]ethanone

Description:
1-[5-(4-Fluorophenyl)-3-isoxazolyl]ethanone, identified by its CAS number 889939-03-1, is an organic compound characterized by its unique structural features. It contains an isoxazole ring, which is a five-membered heterocyclic compound featuring both nitrogen and oxygen atoms, contributing to its reactivity and potential biological activity. The presence of a 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where isoxazole derivatives are often explored for their anti-inflammatory, analgesic, or antimicrobial properties. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 1-[5-(4-Fluorophenyl)-3-isoxazolyl]ethanone represents a compound of interest in chemical research and drug development.
Formula:C11H8FNO2
InChI:InChI=1S/C11H8FNO2/c1-7(14)10-6-11(15-13-10)8-2-4-9(12)5-3-8/h2-6H,1H3
InChI key:InChIKey=BIYBDUDVLCUYCI-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=C(ON1)C2=CC=C(F)C=C2
Synonyms:
  • 1-[5-(4-Fluorophenyl)-1,2-oxazol-3-yl]ethan-1-one
  • Ethanone, 1-[5-(4-fluorophenyl)-3-isoxazolyl]-
  • 1-[5-(4-Fluorophenyl)-3-isoxazolyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.