CAS 889939-25-7
:4-Brom-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin
Description:
4-Brom-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyridine core. The presence of a bromine atom and a phenylsulfonyl group contributes to its unique reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate to high solubility in organic solvents, which is common for many heterocyclic compounds. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. The sulfonyl group can enhance the compound's pharmacological properties, such as improving metabolic stability or modulating biological activity. Additionally, the bromine substituent may facilitate further chemical modifications or serve as a handle for coupling reactions. Overall, 4-Brom-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine represents a versatile scaffold for the synthesis of novel compounds in the field of organic and medicinal chemistry.
Formula:C13H9BrN2O2S
InChI:InChI=1/C13H9BrN2O2S/c14-12-6-8-15-13-11(12)7-9-16(13)19(17,18)10-4-2-1-3-5-10/h1-9H
SMILES:c1ccc(cc1)S(=O)(=O)n1ccc2c(ccnc12)Br
Synonyms:- 1H-pyrrolo[2,3-b]pyridine, 4-bromo-1-(phenylsulfonyl)-
- 4-Bromo-1-(Phenylsulfonyl)-1H-Pyrrolo[2,3-B]Pyridine
- 1-(Benzenesulfonyl)-4-Bromo-Pyrrolo[2,3-B]Pyridine1-Benzenesulfonyl-4-Bromo-7-Azaindole
- 1-(benzenesulfonyl)-4-bromo-1H-pyrrolo[2,3-b]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzenesulfonyl-4-bromo-7-azaindole
CAS:Formula:C13H9BrN2O2SPurity:98%Color and Shape:SolidMolecular weight:337.19184-Bromo-1-benzenesulfonyl-7-azaindole
CAS:4-Bromo-1-benzenesulfonyl-7-azaindolePurity:98%Molecular weight:337.19g/mol1-Benzenesulfonyl-4-bromo-7-azaindole
CAS:1-Benzenesulfonyl-4-bromo-7-azaindole is an amine that can be used in cross-coupling reactions with a variety of organic compounds. It reacts with an electron donor, such as an amine, to form a new carbon–carbon bond. The efficient and specific nature of this reaction has been shown using a palladium catalyst and dioxane as the solvent. 1-Benzenesulfonyl-4-bromo-7-azaindole also undergoes cross coupling reactions with various types of esters, including N,N′-disubstituted esters. This compound is also known by the keywords "BSA" and "BASA".
Formula:C13H9BrN2O2SPurity:Min. 95%Molecular weight:337.19 g/mol



