CAS 889939-42-8

4-bromo-7H-pyrrolo[2,3-d]pyrimidine

Description:

4-Bromo-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 4-position enhances its reactivity and can influence its biological activity. This compound typically exhibits a planar structure, which is conducive to interactions with biological targets, making it of interest in medicinal chemistry. It is often studied for its potential applications in pharmaceuticals, particularly as a scaffold for drug development due to its ability to interact with various biological pathways. The compound is likely to be soluble in organic solvents and may exhibit moderate stability under standard laboratory conditions. Its synthesis usually involves multi-step reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Overall, 4-bromo-7H-pyrrolo[2,3-d]pyrimidine represents a valuable compound in the field of organic and medicinal chemistry.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-6-5-4(1-2-8-5)9-3-10-6/h1-3,8H

SMILES: c1c[nH]c2c1ncnc2Br

Synonyms:

• 7H-Pyrrolo[2,3-d]pyrimidine, 4-bromo-
• 4-Bromo-7H-pyrrolo[2,3-d]pyrimidine
• 4-BROMO-1H-PYRROLO[2,3-D]PYRIMIDINE

4-Bromo-7H-pyrrolo[2,3-d]pyrimidine

CAS: 889939-42-8

Formula: C₆H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA00466Q

4-Bromo-7H-pyrrolo[2,3-d]pyrimidine

CAS: 889939-42-8

4-Bromo-7H-pyrrolo[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 198.02g/mol

Ref: 54-OR906413

4-Bromo-7H-pyrrolo[2,3-d]pyrimidine

CAS: 889939-42-8

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F093302

4-Bromo-7H-pyrrolo[2,3-d]pyrimidine

Controlled Product

CAS: 889939-42-8

Applications 4-Bromo-7H-pyrrolo[2,3-d]pyrimidine

Formula: C₆H₄BrN₃

Color and Shape: Neat

Molecular weight: 198.02

Ref: TR-B687183