CAS 889939-43-9

7-Chloro-2-(3-chlorophenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidine

Description:

7-Chloro-2-(3-chlorophenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a chlorine atom at the 7-position and a 3-chlorophenyl group at the 2-position, contributing to its potential biological activity. The presence of two methyl groups at the 5 and 6 positions enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its unique structural features may confer specific interactions with biological targets, making it of interest in drug discovery. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical entities. Safety and handling precautions should be observed due to the presence of chlorine substituents, which can impart toxicity.

Formula: C₁₄H₁₁Cl₂N₃

InChI: InChI=1S/C14H11Cl2N3/c1-8-9(2)17-13-7-12(18-19(13)14(8)16)10-4-3-5-11(15)6-10/h3-7H,1-2H3

InChI key: InChIKey=DGIZSUGHDHQEFO-UHFFFAOYSA-N

SMILES: ClC=1N2C(=CC(=N2)C3=CC(Cl)=CC=C3)N=C(C)C1C

Synonyms:

• 7-Chloro-2-(3-chlorophenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidine
• Pyrazolo[1,5-a]pyrimidine, 7-chloro-2-(3-chlorophenyl)-5,6-dimethyl-