CAS 889939-44-0

7-Chloro-2-(4-chlorophenyl)-5-phenylpyrazolo[1,5-a]pyrimidine

Description:

7-Chloro-2-(4-chlorophenyl)-5-phenylpyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine framework. This compound features a chlorine atom at the 7-position and a 4-chlorophenyl group at the 2-position, contributing to its potential biological activity. The presence of multiple aromatic rings enhances its lipophilicity, which may influence its pharmacokinetic properties. It is often studied for its potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's unique structure may interact with various biological targets, making it of interest in drug discovery. Additionally, its stability and solubility characteristics are essential for formulation in pharmaceutical applications. As with many synthetic compounds, safety and handling precautions should be observed, as it may exhibit toxicity or environmental hazards. Overall, 7-Chloro-2-(4-chlorophenyl)-5-phenylpyrazolo[1,5-a]pyrimidine represents a significant area of research in the field of organic and medicinal chemistry.

Formula: C₁₈H₁₁Cl₂N₃

InChI: InChI=1S/C18H11Cl2N3/c19-14-8-6-13(7-9-14)16-11-18-21-15(10-17(20)23(18)22-16)12-4-2-1-3-5-12/h1-11H

InChI key: InChIKey=YPHABIMODRQRNI-UHFFFAOYSA-N

SMILES: ClC=1N2C(N=C(C1)C3=CC=CC=C3)=CC(=N2)C4=CC=C(Cl)C=C4

Synonyms:

• 7-Chloro-2-(4-chlorophenyl)-5-phenylpyrazolo[1,5-a]pyrimidine
• Pyrazolo[1,5-a]pyrimidine, 7-chloro-2-(4-chlorophenyl)-5-phenyl-