CAS 889939-46-2
:7-Chloro-2,3-dihydro-1,4-benzodioxin-6-sulfonyl chloride
Description:
7-Chloro-2,3-dihydro-1,4-benzodioxin-6-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a benzodioxin core with a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. This makes it useful in organic synthesis, particularly for the introduction of sulfonyl groups into various organic molecules. The chlorine atom in the structure contributes to its potential as a chlorinating agent. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. However, due to the presence of reactive functional groups, it should be handled with care, following appropriate safety protocols to mitigate risks associated with its reactivity and potential toxicity. As with many chemical substances, proper storage and disposal methods are essential to ensure safety and environmental protection.
Formula:C8H6Cl2O4S
InChI:InChI=1S/C8H6Cl2O4S/c9-5-3-6-7(14-2-1-13-6)4-8(5)15(10,11)12/h3-4H,1-2H2
InChI key:InChIKey=JRUIKHSXGKKVTK-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C2C(=CC1Cl)OCCO2
Synonyms:- 1,4-Benzodioxin-6-sulfonyl chloride, 7-chloro-2,3-dihydro-
- 7-Chloro-2,3-dihydro-1,4-benzodioxin-6-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Chloro-2,3-dihydrobenzo[b][1,4]dioxine-6-sulfonyl chloride
CAS:Formula:C8H6Cl2O4SMolecular weight:269.1018
