CAS 889939-47-3

7-Chloro-2,5-dimethyl-3-(2-thienyl)pyrazolo[1,5-a]pyrimidine

Description:

7-Chloro-2,5-dimethyl-3-(2-thienyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core fused with a thienyl group. This compound features a chlorine atom at the 7-position and two methyl groups at the 2 and 5 positions of the pyrazolo-pyrimidine ring, contributing to its unique chemical properties. The presence of the thienyl group enhances its potential for biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. Additionally, the chlorine substituent may impart specific reactivity and stability characteristics. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents targeting various biological pathways. However, detailed studies on its pharmacological properties and mechanisms of action would be necessary to fully understand its potential applications.

Formula: C₁₂H₁₀ClN₃S

InChI: InChI=1S/C12H10ClN3S/c1-7-6-10(13)16-12(14-7)11(8(2)15-16)9-4-3-5-17-9/h3-6H,1-2H3

InChI key: InChIKey=OSRUUJFRLADCGK-UHFFFAOYSA-N

SMILES: CC=1C(=C2N(C(Cl)=CC(C)=N2)N1)C3=CC=CS3

Synonyms:

• 7-Chloro-2,5-dimethyl-3-(2-thienyl)pyrazolo[1,5-a]pyrimidine
• Pyrazolo[1,5-a]pyrimidine, 7-chloro-2,5-dimethyl-3-(2-thienyl)-