
CAS 889939-49-5
:7-Chloro-2-(3-methoxyphenyl)-5-phenylpyrazolo[1,5-a]pyrimidine
Description:
7-Chloro-2-(3-methoxyphenyl)-5-phenylpyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine core. This compound features a chlorine atom at the 7-position and a methoxy-substituted phenyl group at the 2-position, along with a phenyl group at the 5-position, contributing to its potential biological activity. The presence of the methoxy group enhances lipophilicity, which may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, possibly exhibiting anti-inflammatory or anticancer properties. Its molecular structure suggests it may interact with various biological targets, making it a candidate for further research. As with many heterocyclic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions should be observed due to the presence of chlorine, which can impart toxicity.
Formula:C19H14ClN3O
InChI:InChI=1S/C19H14ClN3O/c1-24-15-9-5-8-14(10-15)17-12-19-21-16(11-18(20)23(19)22-17)13-6-3-2-4-7-13/h2-12H,1H3
InChI key:InChIKey=SWWUWCABWYBJFW-UHFFFAOYSA-N
SMILES:ClC=1N2C(=CC(=N2)C3=CC(OC)=CC=C3)N=C(C1)C4=CC=CC=C4
Synonyms:- Pyrazolo[1,5-a]pyrimidine, 7-chloro-2-(3-methoxyphenyl)-5-phenyl-
- 7-Chloro-2-(3-methoxyphenyl)-5-phenylpyrazolo[1,5-a]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.