CAS 889939-55-3

2,2-Di-2-propen-1-ylazetidine

Description:

2,2-Di-2-propen-1-ylazetidine, identified by its CAS number 889939-55-3, is a chemical compound characterized by its unique azetidine ring structure, which is a four-membered cyclic amine. This compound features two propenyl groups attached to the nitrogen atom of the azetidine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the propenyl groups suggests that it may participate in various chemical reactions, such as polymerization or addition reactions, making it of interest in materials science and medicinal chemistry. The azetidine ring itself can impart specific steric and electronic properties, influencing the compound's behavior in chemical reactions. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular structure and the presence of functional groups. Overall, 2,2-Di-2-propen-1-ylazetidine represents a versatile building block in synthetic chemistry, with potential applications in developing new materials or pharmaceuticals.

Formula: C₉H₁₅N

InChI: InChI=1S/C9H15N/c1-3-5-9(6-4-2)7-8-10-9/h3-4,10H,1-2,5-8H2

InChI key: InChIKey=KOZNKNLZYURHEC-UHFFFAOYSA-N

SMILES: C(C=C)C1(CC=C)CCN1

Synonyms:

• 2,2-Di-2-propen-1-ylazetidine
• Azetidine, 2,2-di-2-propenyl-
• 2,2-Bis(prop-2-enyl)azetidine
• Azetidine, 2,2-di-2-propen-1-yl-
• 2,2-Bis(prop-2-en-1-yl)azetidine