
CAS 889939-58-6
:β-(3,4-Dimethoxyphenyl)-1-pyrrolidineethanamine
Description:
β-(3,4-Dimethoxyphenyl)-1-pyrrolidineethanamine, identified by its CAS number 889939-58-6, is a chemical compound that belongs to the class of phenethylamines. This substance features a pyrrolidine ring, which contributes to its structural complexity and potential biological activity. The presence of the 3,4-dimethoxyphenyl group suggests that it may exhibit interesting electronic properties and interactions due to the methoxy substituents, which can influence its solubility and reactivity. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system, given the structural motifs commonly associated with psychoactive compounds. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. Additionally, the compound's safety profile, including toxicity and pharmacokinetics, would need to be assessed in a laboratory setting to understand its potential applications and risks.
Formula:C14H22N2O2
InChI:InChI=1S/C14H22N2O2/c1-17-13-6-5-11(9-14(13)18-2)12(10-15)16-7-3-4-8-16/h5-6,9,12H,3-4,7-8,10,15H2,1-2H3
InChI key:InChIKey=WQYZFTUTVPPVGV-UHFFFAOYSA-N
SMILES:C(CN)(C1=CC(OC)=C(OC)C=C1)N2CCCC2
Synonyms:- β-(3,4-Dimethoxyphenyl)-1-pyrrolidineethanamine
- 1-Pyrrolidineethanamine, β-(3,4-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.