
CAS 889939-61-1
:2,5-Dihydro-3,4-dimethyl-5-oxo-1H-pyrazole-1-acetic acid
Description:
2,5-Dihydro-3,4-dimethyl-5-oxo-1H-pyrazole-1-acetic acid is a pyrazole derivative characterized by its unique structural features, including a pyrazole ring and an acetic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, which is common for many pyrazole derivatives. The presence of the keto group and the acetic acid moiety contributes to its potential reactivity and biological activity. Pyrazoles are known for their diverse pharmacological properties, including anti-inflammatory and analgesic effects, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could lead to various applications in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2,5-Dihydro-3,4-dimethyl-5-oxo-1H-pyrazole-1-acetic acid represents a class of compounds that may offer valuable insights into the design of new therapeutic agents.
Formula:C7H10N2O3
InChI:InChI=1S/C7H10N2O3/c1-4-5(2)8-9(7(4)12)3-6(10)11/h8H,3H2,1-2H3,(H,10,11)
InChI key:InChIKey=OAZILZBSQTUYNS-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C(=O)C(C)=C(C)N1
Synonyms:- 2,5-Dihydro-3,4-dimethyl-5-oxo-1H-pyrazole-1-acetic acid
- 1H-Pyrazole-1-acetic acid, 2,5-dihydro-3,4-dimethyl-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.