CAS 889939-67-7

4-Ethoxy-3-methoxybenzenepropanamine

Description:

4-Ethoxy-3-methoxybenzenepropanamine, identified by its CAS number 889939-67-7, is an organic compound characterized by its aromatic structure and the presence of both ethoxy and methoxy functional groups. This compound features a propanamine side chain, which contributes to its amine properties. The ethoxy group typically enhances the solubility of the compound in organic solvents, while the methoxy group can influence its reactivity and interaction with other chemical species. The presence of these substituents on the benzene ring can affect the compound's electronic properties, potentially making it a candidate for various applications in pharmaceuticals or organic synthesis. Additionally, the amine functionality may impart basic characteristics, allowing for interactions with acids and other electrophiles. Overall, the unique combination of functional groups in 4-Ethoxy-3-methoxybenzenepropanamine suggests potential utility in medicinal chemistry and materials science, although specific applications would depend on further research into its biological activity and chemical behavior.

Formula: C₁₂H₁₉NO₂

InChI: InChI=1S/C12H19NO2/c1-3-15-11-7-6-10(5-4-8-13)9-12(11)14-2/h6-7,9H,3-5,8,13H2,1-2H3

InChI key: InChIKey=AETJHINOZUXDCQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(OCC)C=CC(CCCN)=C1

Synonyms:

• 4-Ethoxy-3-methoxybenzenepropanamine
• Benzenepropanamine, 4-ethoxy-3-methoxy-