CAS 889939-72-4

4-Ethyl-1,2,3-thiadiazole-5-carbonyl chloride

Description:

4-Ethyl-1,2,3-thiadiazole-5-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a carbonyl chloride functional group. This compound typically exhibits properties associated with both heterocyclic compounds and acyl chlorides. The presence of the thiadiazole ring contributes to its potential reactivity, particularly in nucleophilic substitution reactions, while the carbonyl chloride group makes it a reactive acyl chloride, capable of participating in acylation reactions. It is often used in organic synthesis and may serve as an intermediate in the preparation of various pharmaceuticals or agrochemicals. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. As with many acyl chlorides, it may be sensitive to moisture and can react vigorously with water, releasing hydrochloric acid. Safety precautions should be taken when handling this compound due to its potential irritant properties and reactivity.

Formula: C₅H₅ClN₂OS

InChI: InChI=1S/C5H5ClN2OS/c1-2-3-4(5(6)9)10-8-7-3/h2H2,1H3

InChI key: InChIKey=LDFUVWIMAFQDBW-UHFFFAOYSA-N

SMILES: C(C)C1=C(C(Cl)=O)SN=N1

Synonyms:

• 1,2,3-Thiadiazole-5-carbonyl chloride, 4-ethyl-
• 4-Ethyl-1,2,3-thiadiazole-5-carbonyl chloride