CAS 889939-78-0

4-(2-Fluorophenyl)tetrahydro-2H-pyran-4-methanamine

Description:

4-(2-Fluorophenyl)tetrahydro-2H-pyran-4-methanamine, identified by its CAS number 889939-78-0, is a chemical compound that features a tetrahydropyran ring substituted with a fluorophenyl group and a methanamine moiety. This compound is characterized by its unique structural framework, which includes a six-membered saturated ring (tetrahydropyran) that contributes to its potential biological activity. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The methanamine group introduces basicity, which may play a role in the compound's solubility and reactivity. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. However, specific properties such as melting point, boiling point, solubility, and toxicity would require empirical data for a comprehensive understanding of its behavior in various environments.

Formula: C₁₂H₁₆FNO

InChI: InChI=1S/C12H16FNO/c13-11-4-2-1-3-10(11)12(9-14)5-7-15-8-6-12/h1-4H,5-9,14H2

InChI key: InChIKey=GHWCDYSBZXDILZ-UHFFFAOYSA-N

SMILES: C(N)C1(CCOCC1)C2=C(F)C=CC=C2

Synonyms:

• 2H-Pyran-4-methanamine, 4-(2-fluorophenyl)tetrahydro-
• [4-(2-Fluorophenyl)tetrahydropyran-4-yl]methanamine
• 4-(2-Fluorophenyl)tetrahydro-2H-pyran-4-methanamine

[4-(2-Fluorophenyl)oxan-4-yl]methanamine

CAS: 889939-78-0

Formula: C₁₂H₁₆FNO

Molecular weight: 209.2599

Ref: IN-DA0088XN

[4-(2-Fluorophenyl)oxan-4-yl]methanamine

CAS: 889939-78-0

[4-(2-Fluorophenyl)oxan-4-yl]methanamine

Purity: ≥95%

Molecular weight: 209.26g/mol

Ref: 54-PC403139