
CAS 889939-91-7
:N-Methyl-β-phenyl-1-piperidineethanamine
Description:
N-Methyl-β-phenyl-1-piperidineethanamine, also known by its CAS number 889939-91-7, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered ring containing one nitrogen atom, and is substituted with a methyl group and a phenyl group. The presence of the β-phenyl group indicates that the phenyl substituent is attached to the carbon adjacent to the nitrogen in the piperidine structure. This compound may exhibit psychoactive properties and is of interest in medicinal chemistry for its potential applications in treating various neurological conditions. Its molecular structure suggests that it may interact with neurotransmitter systems, particularly those involving monoamines. As with many piperidine derivatives, it is essential to consider its pharmacological profile, including its potency, selectivity, and safety profile, when evaluating its potential therapeutic uses. Proper handling and safety measures should be observed due to the potential for biological activity.
Formula:C14H22N2
InChI:InChI=1S/C14H22N2/c1-15-12-14(13-8-4-2-5-9-13)16-10-6-3-7-11-16/h2,4-5,8-9,14-15H,3,6-7,10-12H2,1H3
InChI key:InChIKey=OTALFDMWEXVUBN-UHFFFAOYSA-N
SMILES:C(CNC)(C1=CC=CC=C1)N2CCCCC2
Synonyms:- N-Methyl-β-phenyl-1-piperidineethanamine
- 1-Piperidineethanamine, N-methyl-β-phenyl-
- METHYL-(2-PHENYL-2-PIPERIDIN-1-YL-ETHYL)-AMINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.