CAS 889939-98-4
:6-Methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Description:
6-Methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic compound characterized by its pyrazolo and pyrimidine ring structures, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its acidity and solubility in polar solvents. The presence of the methyl group at the 6-position of the pyrazolo ring influences its reactivity and potential biological activity. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The compound's molecular structure allows for various synthetic modifications, making it a versatile building block in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for further research and development. As with many heterocycles, its properties can be influenced by substituents and the overall molecular environment, making it an interesting subject for further investigation in both theoretical and applied chemistry contexts.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-5-3-9-7-2-6(8(12)13)10-11(7)4-5/h2-4H,1H3,(H,12,13)
InChI key:InChIKey=KTXQJOIYJTZWDA-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2N(N1)C=C(C)C=N2
Synonyms:- Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 6-methyl-
- 6-Methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.