CAS 889940-07-2

4,5,6,7-Tetrahydro-1H-indazole-1-propanoic acid

Description:

4,5,6,7-Tetrahydro-1H-indazole-1-propanoic acid is a chemical compound characterized by its unique bicyclic structure, which includes a saturated indazole ring system. This compound features a propanoic acid functional group, contributing to its potential as a bioactive molecule. The presence of the tetrahydroindazole moiety suggests that it may exhibit interesting pharmacological properties, possibly influencing neurotransmitter systems or other biological pathways. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, which can participate in hydrogen bonding. Its molecular structure may allow for various interactions with biological targets, making it a candidate for research in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of functional groups and the overall steric environment. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1S/C10H14N2O2/c13-10(14)5-6-12-9-4-2-1-3-8(9)7-11-12/h7H,1-6H2,(H,13,14)

InChI key: InChIKey=MPVUUVBXIBMYNJ-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C2=C(C=N1)CCCC2

Synonyms:

• 1H-Indazole-1-propanoic acid, 4,5,6,7-tetrahydro-
• 4,5,6,7-Tetrahydro-1H-indazole-1-propanoic acid

3-(4,5,6,7-Tetrahydro-indazol-1-yl)-propionic acid

CAS: 889940-07-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-PKB94007