CAS 889940-14-1
:N,N,N'-trimethyl-N'-(piperidin-4-yl)ethane-1,2-diamine
Description:
N,N,N'-trimethyl-N'-(piperidin-4-yl)ethane-1,2-diamine, with the CAS number 889940-14-1, is a chemical compound characterized by its amine functional groups and a piperidine ring. This substance features a central ethane backbone with two amine groups and three methyl groups attached to the nitrogen atoms, contributing to its trimethylated structure. The presence of the piperidine ring, a six-membered saturated heterocycle containing one nitrogen atom, imparts unique properties such as potential basicity and the ability to participate in hydrogen bonding. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in water and organic solvents can vary, influenced by the presence of the polar amine groups. Due to its structural characteristics, it may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Safety data should be consulted for handling, as amines can be irritants and may pose health risks.
Formula:C10H23N3
InChI:InChI=1/C10H23N3/c1-12(2)8-9-13(3)10-4-6-11-7-5-10/h10-11H,4-9H2,1-3H3
SMILES:CN(C)CCN(C)C1CCNCC1
Synonyms:- Ethylenediamine, N,N,N'-trimethyl-N'-(4-piperidyl)-
- N-[2-(dimethylamino)ethyl]-N-methylpiperidin-4-amine
- N,N,N'-trimethyl-N'-piperidin-4-ylethane-1,2-diamine(SALTDATA: 3HCl)
- CHEMBRDG-BB 4100999
- N,N,N'-TRIMETHYL-N'-PIPERIDIN-4-YL-ETHANE-1,2-DIAMINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
