CAS 889940-47-0

2-[(6-methylquinazolin-4-yl)amino]ethanol

Description:

2-[(6-Methylquinazolin-4-yl)amino]ethanol is an organic compound characterized by its quinazoline core, which is a bicyclic structure containing both benzene and pyrimidine rings. This compound features an amino group attached to the quinazoline ring and an ethanol moiety, contributing to its potential as a bioactive molecule. The presence of the methyl group at the 6-position of the quinazoline enhances its lipophilicity and may influence its biological activity. The aminoethanol part of the molecule can participate in hydrogen bonding, which is significant for interactions with biological targets, such as enzymes or receptors. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions and the presence of other chemical species.

Formula: C₁₁H₁₃N₃O

InChI: InChI=1/C11H13N3O/c1-8-2-3-10-9(6-8)11(12-4-5-15)14-7-13-10/h2-3,6-7,15H,4-5H2,1H3,(H,12,13,14)

SMILES: Cc1ccc2c(c1)c(=NCCO)[nH]cn2

Synonyms:

• Ethanol, 2-[(6-Methyl-4-Quinazolinyl)Amino]-
• 2-[(6-Methylquinazolin-4-yl)amino]ethanol