CAS 889940-49-2

4-Methyl-2-[2-[(1-methylethyl)amino]-2-oxoethyl]-5-thiazolecarboxylic acid

Description:

4-Methyl-2-[2-[(1-methylethyl)amino]-2-oxoethyl]-5-thiazolecarboxylic acid, with the CAS number 889940-49-2, is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing sulfur and nitrogen. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a methyl group and an isopropylamino side chain enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its thiazole moiety is often associated with various biological activities, including antimicrobial and anti-inflammatory properties. As with many thiazole derivatives, the compound may exhibit unique interactions with biological targets, making it of interest in medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₄N₂O₃S

InChI: InChI=1S/C10H14N2O3S/c1-5(2)11-7(13)4-8-12-6(3)9(16-8)10(14)15/h5H,4H2,1-3H3,(H,11,13)(H,14,15)

InChI key: InChIKey=FWDQMPJNVCLOKR-UHFFFAOYSA-N

SMILES: C(C(NC(C)C)=O)C=1SC(C(O)=O)=C(C)N1

Synonyms:

• 4-Methyl-2-[2-[(1-methylethyl)amino]-2-oxoethyl]-5-thiazolecarboxylic acid
• 5-Thiazolecarboxylic acid, 4-methyl-2-[2-[(1-methylethyl)amino]-2-oxoethyl]-