CAS 889941-08-6
:4,5,6,7-Tetrahydro-1-(tetrahydro-1,1-dioxido-3-thienyl)-1H-indazole-3-carboxylic acid
Description:
4,5,6,7-Tetrahydro-1-(tetrahydro-1,1-dioxido-3-thienyl)-1H-indazole-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes an indazole core fused with a tetrahydro-thienyl moiety. This compound features multiple functional groups, including a carboxylic acid and dioxido groups, contributing to its potential reactivity and solubility properties. The presence of the tetrahydro and thienyl rings suggests that it may exhibit unique stereochemical properties and could participate in various chemical reactions, such as nucleophilic substitutions or acid-base reactions. Its molecular structure may also influence its biological activity, making it of interest in medicinal chemistry. The compound's CAS number, 889941-08-6, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this substance's intricate architecture and functional groups position it as a candidate for further investigation in both synthetic and pharmaceutical chemistry.
Formula:C12H16N2O4S
InChI:InChI=1S/C12H16N2O4S/c15-12(16)11-9-3-1-2-4-10(9)14(13-11)8-5-6-19(17,18)7-8/h8H,1-7H2,(H,15,16)
InChI key:InChIKey=XJWKTFSPDLRWAP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NN(C2=C1CCCC2)C3CS(=O)(=O)CC3
Synonyms:- 4,5,6,7-Tetrahydro-1-(tetrahydro-1,1-dioxido-3-thienyl)-1H-indazole-3-carboxylic acid
- 1H-Indazole-3-carboxylic acid, 4,5,6,7-tetrahydro-1-(tetrahydro-1,1-dioxido-3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.