CymitQuimica logo

CAS 889942-43-2

:

4-(3-piperidyl)benzoic acid

Description:
4-(3-Piperidyl)benzoic acid is an organic compound characterized by its structure, which consists of a benzoic acid moiety substituted with a piperidine ring at the para position. This compound features a carboxylic acid functional group (-COOH) that contributes to its acidic properties, making it soluble in polar solvents. The piperidine ring, a six-membered nitrogen-containing heterocycle, imparts basic characteristics and can participate in various chemical reactions, including nucleophilic substitutions. The presence of both the aromatic and aliphatic components in its structure allows for diverse interactions, making it of interest in medicinal chemistry and drug development. Its potential applications may include roles as intermediates in the synthesis of pharmaceuticals or as ligands in coordination chemistry. Additionally, the compound's unique structural features may influence its biological activity, making it a candidate for further research in therapeutic contexts. As with many organic compounds, proper handling and storage are essential to maintain stability and prevent degradation.
Formula:C12H15NO2
InChI:InChI=1/C12H15NO2/c14-12(15)10-5-3-9(4-6-10)11-2-1-7-13-8-11/h3-6,11,13H,1-2,7-8H2,(H,14,15)
SMILES:C1CC(CNC1)c1ccc(cc1)C(=O)O
Synonyms:
  • 4-(Piperidin-3-yl)benzoic acid
  • Benzoic acid, 4-(3-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.