CymitQuimica logo

CAS 889942-56-7

:

tert-Butyl 3-(morpholine-4-carbonyl)piperidine-1-carboxylate

Description:
Tert-Butyl 3-(morpholine-4-carbonyl)piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a morpholine moiety, and a tert-butyl ester group. This compound typically exhibits properties associated with both amides and esters, such as moderate solubility in organic solvents and potential reactivity under various conditions. The presence of the morpholine ring suggests that it may have biological activity, possibly interacting with biological targets due to its nitrogen-containing heterocycles. The tert-butyl group contributes to the compound's lipophilicity, which can influence its pharmacokinetic properties if used in medicinal chemistry. Additionally, the carboxylate functionality may participate in hydrogen bonding and other interactions, affecting its stability and reactivity. Overall, this compound's unique structural features make it of interest in fields such as drug development and organic synthesis, where its specific characteristics can be leveraged for various applications.
Formula:C15H26N2O4
InChI:InChI=1/C15H26N2O4/c1-15(2,3)21-14(19)17-6-4-5-12(11-17)13(18)16-7-9-20-10-8-16/h12H,4-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCCC(C1)C(=O)N1CCOCC1
Synonyms:
  • 3-(4-Morpholinylcarbonyl)-1-piperidinecarboxylic acid 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.