CAS 889942-64-7
:6-chloro-N'-hydroxy-1H-indole-3-carboxamidine
Description:
6-Chloro-N'-hydroxy-1H-indole-3-carboxamidine is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chloro group at the 6-position and a hydroxy group at the N'-position contributes to its unique reactivity and potential biological activity. The carboxamidine functional group enhances its ability to form hydrogen bonds, which may influence its interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit properties such as antimicrobial or anticancer activity. Its molecular structure allows for various modifications, which can be explored to optimize its pharmacological profile. As with many chemical substances, safety and handling precautions are essential, and its properties should be studied in detail through experimental research to fully understand its behavior in biological systems.
Formula:C9H8ClN3O
InChI:InChI=1/C9H8ClN3O/c10-5-1-2-6-7(9(11)13-14)4-12-8(6)3-5/h1-4,12,14H,(H2,11,13)
SMILES:c1cc2c(c[nH]c2cc1Cl)C(=N)NO
Synonyms:- 1H-indole-3-carboximidamide, 6-chloro-N'-hydroxy-
- 6-chloro-N'-hydroxy-1H-indole-3-carboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
