CAS 889942-73-8
:4-chloro-1H-indole-3-carbonitrile
Description:
4-Chloro-1H-indole-3-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 4-position and a cyano group (-C≡N) at the 3-position of the indole ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The cyano group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the chlorine substituent can influence the compound's reactivity and interaction with biological targets. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, 4-chloro-1H-indole-3-carbonitrile is an important compound in the field of organic chemistry and drug development.
Formula:C9H5ClN2
InChI:InChI=1/C9H5ClN2/c10-7-2-1-3-8-9(7)6(4-11)5-12-8/h1-3,5,12H
SMILES:c1cc(c2c(C#N)c[nH]c2c1)Cl
Synonyms:- 1H-indole-3-carbonitrile, 4-chloro-
- 4-Chloro-1H-indole-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
