CAS 889942-79-4

4-Methoxy-1H-indole-3-carbonitrile

Description:

4-Methoxy-1H-indole-3-carbonitrile is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methoxy group (-OCH3) at the 4-position and a cyano group (-CN) at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, including anti-cancer and anti-inflammatory properties. The cyano group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the methoxy group can influence the electronic properties of the indole ring, affecting its reactivity and interaction with biological targets. As with many indole derivatives, 4-Methoxy-1H-indole-3-carbonitrile may also exhibit fluorescence, which can be useful in various analytical applications. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₁₀H₈N₂O

InChI: InChI=1S/C10H8N2O/c1-13-9-4-2-3-8-10(9)7(5-11)6-12-8/h2-4,6,12H,1H3

InChI key: InChIKey=CQQKEAUKMZGVCS-UHFFFAOYSA-N

SMILES: C(#N)C=1C=2C(NC1)=CC=CC2OC

Synonyms:

• 4-Methoxy-1H-Indole-3-Carbonitrile
• 4-Methoxyindole-3-Carbonitrile
• 1H-Indole-3-carbonitrile, 4-methoxy-

4-Methoxy-1H-Indole-3-Carbonitrile

CAS: 889942-79-4

Formula: C₁₀H₈N₂O

Molecular weight: 172.1833

Ref: IN-DA004408