CymitQuimica logo

CAS 889942-89-6

:

2-Chloro-α-ethenyl-4-pyridinemethanol

Description:
2-Chloro-α-ethenyl-4-pyridinemethanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group and an ethenyl group contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits polar characteristics due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The chloro substituent may enhance electrophilic reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's structure suggests potential biological activity, which could be explored in medicinal chemistry. Its specific properties, such as melting point, boiling point, and spectral data, would be determined through experimental methods. As with many pyridine derivatives, it may also exhibit interesting interactions with biological systems, warranting further investigation for potential pharmaceutical applications. Safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C8H8ClNO
InChI:InChI=1S/C8H8ClNO/c1-2-7(11)6-3-4-10-8(9)5-6/h2-5,7,11H,1H2
InChI key:InChIKey=MBAHPOQFPJSWOA-UHFFFAOYSA-N
SMILES:C(C=C)(O)C=1C=C(Cl)N=CC1
Synonyms:
  • 2-Chloro-α-ethenyl-4-pyridinemethanol
  • 4-Pyridinemethanol, 2-chloro-α-ethenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.