CAS 889943-46-8

2-Ethoxybenzenecarboximidic acid hydrazide

Description:

2-Ethoxybenzenecarboximidic acid hydrazide is a chemical compound characterized by its unique functional groups, which include an ethoxy group, a carboximidic acid moiety, and a hydrazide structure. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the hydrazide functional group. The ethoxy group contributes to its hydrophobic character, influencing its solubility and interaction with biological systems. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the carboximidic acid group suggests potential for tautomerism and reactivity in various chemical reactions, including condensation and coupling reactions. Overall, 2-Ethoxybenzenecarboximidic acid hydrazide represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₉H₁₃N₃O

InChI: InChI=1S/C9H13N3O/c1-2-13-8-6-4-3-5-7(8)9(10)12-11/h3-6H,2,11H2,1H3,(H2,10,12)

InChI key: InChIKey=AIRIJTSCJYEFNI-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C(NN)=N)C=CC=C1

Synonyms:

• Benzenecarboximidic acid, 2-ethoxy-, hydrazide
• 2-Ethoxybenzimidohydrazide
• 2-Ethoxybenzenecarboximidic acid hydrazide

2-Ethoxybenzimidohydrazide

CAS: 889943-46-8

Formula: C₉H₁₃N₃O

Purity: 95%

Molecular weight: 179.2190

Ref: IN-DA00IFJ9

Vardenafil Impurity 13 HCl

CAS: 889943-46-8

Formula: C₉H₁₃N₃O·HCl

Color and Shape: White To Off-White Solid

Molecular weight: 179.22 36.46

Ref: 4Z-V-0538

2-Ethoxybenzimidohydrazide Hydrochloride

Controlled Product

CAS: 889943-46-8

Stability Hygroscopic
Applications 2-Ethoxybenzimidohydrazide Hydrochloride, is a derivative of Vardenafil (V098001), an erectile dysfunction (ED) drug and an inhibitor of phosphodiesterase type 5 (PDE-5) enzyme.
References Reddy, Vajrala Venkata., et al.: Synth. Commun., 42, 3513(2012)

Formula: C₉H₁₃N₃O•HCl

Color and Shape: Neat

Molecular weight: 179.223646

Ref: TR-E891315

2-Ethoxybenzimidohydrazide

CAS: 889943-46-8

Formula: C₉H₁₃N₃O

Molecular weight: 179.22

Ref: ST-EA-CP-V28029