CymitQuimica logo

CAS 889943-47-9

:

3-(3-Piperidinyl)-1,2,4-triazolo[4,3-a]pyridine

Description:
3-(3-Piperidinyl)-1,2,4-triazolo[4,3-a]pyridine is a chemical compound characterized by its unique bicyclic structure, which combines a triazole ring with a pyridine moiety. The presence of the piperidine group contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific formulation and purity. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's CAS number, 889943-47-9, allows for precise identification in chemical databases and literature. As with many heterocyclic compounds, it may possess specific reactivity patterns, making it suitable for further chemical modifications or as a building block in synthetic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H14N4
InChI:InChI=1S/C11H14N4/c1-2-7-15-10(5-1)13-14-11(15)9-4-3-6-12-8-9/h1-2,5,7,9,12H,3-4,6,8H2
InChI key:InChIKey=ZWXUXOSRVISZHS-UHFFFAOYSA-N
SMILES:C=1(N2C(=NN1)C=CC=C2)C3CCCNC3
Synonyms:
  • 3-(3-Piperidinyl)-1,2,4-triazolo[4,3-a]pyridine
  • 3-[[1,2,4]Triazolo[4,3-a]pyridin-3-yl]piperidine
  • 1,2,4-Triazolo[4,3-a]pyridine, 3-(3-piperidinyl)-
  • 3-(Piperidin-3-yl)-[1,2,4]triazolo[4,3-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.