CAS 889943-82-2
:N'-hydroxy-4-methoxy-1H-indole-3-carboxamidine
Description:
N'-hydroxy-4-methoxy-1H-indole-3-carboxamidine is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a hydroxylamine functional group (-NHOH) at the N' position, which contributes to its reactivity and potential biological activity. The presence of a methoxy group (-OCH3) at the 4-position of the indole ring enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The carboxamidine functional group (-C(=NH)NH2) at the 3-position is significant for its role in biological activity, as it can participate in hydrogen bonding and may interact with various biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further research and characterization in biological systems.
Formula:C10H11N3O2
InChI:InChI=1/C10H11N3O2/c1-15-8-4-2-3-7-9(8)6(5-12-7)10(11)13-14/h2-5,12,14H,1H3,(H2,11,13)
SMILES:COc1cccc2c1c(c[nH]2)C(=N)NO
Synonyms:- 1H-indole-3-carboximidamide, N'-hydroxy-4-methoxy-
- N-hydroxy-4-methoxy-1H-indole-3-carboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
