CymitQuimica logo

CAS 889944-18-7

:

2-Methyl-1h-indole-3-carboxamidine

Description:
2-Methyl-1H-indole-3-carboxamidine, with the CAS number 889944-18-7, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methyl group at the second position of the indole ring and a carboxamidine functional group at the third position. The presence of the carboxamidine group imparts basic properties to the molecule, making it potentially useful in various chemical reactions and applications. It is often studied for its biological activity, particularly in medicinal chemistry, where indole derivatives are known for their diverse pharmacological properties. The compound is typically solid at room temperature and may exhibit solubility in polar solvents. Its reactivity can be influenced by the functional groups present, allowing for potential modifications that could enhance its biological efficacy or alter its physicochemical properties. As with many organic compounds, safety data should be consulted before handling, as it may pose health risks.
Formula:C10H11N3
InChI:InChI=1S/C10H11N3/c1-6-9(10(11)12)7-4-2-3-5-8(7)13-6/h2-5,13H,1H3,(H3,11,12)
SMILES:Cc1c(c2ccccc2[nH]1)C(=N)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.